C18H23ClN4O4 — CID 91294813
propan-2-yl 4-[1-[3-(6-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]ethoxy]piperidine-1-carboxylate (PubChem CID 91294813) has the molecular formula C18H23ClN4O4 and a molecular weight of 394.86 g/mol. Its IUPAC name is propan-2-yl 4-[1-[3-(6-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]ethoxy]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[1-[3-(6-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]ethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91294813 |
| Molecular Formula | C18H23ClN4O4 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | propan-2-yl 4-[1-[3-(6-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]ethoxy]piperidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC(OC(C)c2nc(-c3ccc(Cl)nc3)no2)CC1 |
| InChI | InChI=1S/C18H23ClN4O4/c1-11(2)25-18(24)23-8-6-14(7-9-23)26-12(3)17-21-16(22-27-17)13-4-5-15(19)20-10-13/h4-5,10-12,14H,6-9H2,1-3H3 |
| InChIKey | IJQDEEFNCZIGML-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 90.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|