C25H23F3N4O2 — CID 91295250
1-(3,4-difluorophenyl)-1-[6-[(6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-yl)methyl]-3-pyridinyl]-N-methoxymethanimine (PubChem CID 91295250) has the molecular formula C25H23F3N4O2 and a molecular weight of 468.48 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-1-[6-[(6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-yl)methyl]-3-pyridinyl]-N-methoxymethanimine.
| Compound Name | 1-(3,4-difluorophenyl)-1-[6-[(6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-yl)methyl]-3-pyridinyl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 91295250 |
| Molecular Formula | C25H23F3N4O2 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 1-(3,4-difluorophenyl)-1-[6-[(6-fluorospiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-yl)methyl]-3-pyridinyl]-N-methoxymethanimine |
| SMILES | CON=C(c1ccc(CN2CCC3(CC2)OCc2cc(F)ncc23)nc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C25H23F3N4O2/c1-33-31-24(16-3-5-21(26)22(27)10-16)17-2-4-19(29-12-17)14-32-8-6-25(7-9-32)20-13-30-23(28)11-18(20)15-34-25/h2-5,10-13H,6-9,14-15H2,1H3 |
| InChIKey | SWCCAMAWSJCXTI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 59.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|