C24H27N — CID 91295251
ethane;2-methyl-N-phenyl-N-(4-prop-1-enylphenyl)aniline (PubChem CID 91295251) has the molecular formula C24H27N and a molecular weight of 329.49 g/mol. Its IUPAC name is ethane;2-methyl-N-phenyl-N-(4-prop-1-enylphenyl)aniline.
| Compound Name | ethane;2-methyl-N-phenyl-N-(4-prop-1-enylphenyl)aniline |
|---|---|
| PubChem CID | 91295251 |
| Molecular Formula | C24H27N |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | ethane;2-methyl-N-phenyl-N-(4-prop-1-enylphenyl)aniline |
| SMILES | CC.CC=Cc1ccc(N(c2ccccc2)c2ccccc2C)cc1 |
| InChI | InChI=1S/C22H21N.C2H6/c1-3-9-19-14-16-21(17-15-19)23(20-11-5-4-6-12-20)22-13-8-7-10-18(22)2;1-2/h3-17H,1-2H3;1-2H3 |
| InChIKey | QDVXYPVODGJWKA-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |