C14H24N2O4 — CID 91295359
3-O-ethyl 2-O-methyl (3R,4aR,6S,8aR)-6-amino-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate (PubChem CID 91295359) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-O-ethyl 2-O-methyl (3R,4aR,6S,8aR)-6-amino-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate.
| Compound Name | 3-O-ethyl 2-O-methyl (3R,4aR,6S,8aR)-6-amino-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 91295359 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 3-O-ethyl 2-O-methyl (3R,4aR,6S,8aR)-6-amino-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H]2C[C@@H](N)CC[C@H]2CN1C(=O)OC |
| InChI | InChI=1S/C14H24N2O4/c1-3-20-13(17)12-7-10-6-11(15)5-4-9(10)8-16(12)14(18)19-2/h9-12H,3-8,15H2,1-2H3/t9-,10+,11-,12+/m0/s1 |
| InChIKey | YAMJGNTYDZELGF-WHOHXGKFSA-N |
| XLogP | 1.13 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |