C11H13N — CID 91296247
3a,4,4a,5-tetrahydro-1H-pyrrolo[1,2-a]indole (PubChem CID 91296247) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 3a,4,4a,5-tetrahydro-1H-pyrrolo[1,2-a]indole.
| Compound Name | 3a,4,4a,5-tetrahydro-1H-pyrrolo[1,2-a]indole |
|---|---|
| PubChem CID | 91296247 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 3a,4,4a,5-tetrahydro-1H-pyrrolo[1,2-a]indole |
| SMILES | C1=CCC2CC3C=CCN3C2=C1 |
| InChI | InChI=1S/C11H13N/c1-2-6-11-9(4-1)8-10-5-3-7-12(10)11/h1-3,5-6,9-10H,4,7-8H2 |
| InChIKey | ABOMFRPDCQTKRT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|