C42H72O5 — CID 91296796
4-[2,3-bis(2-ethylpenta-3,4-dienoxy)propoxymethyl]hexa-1,2-diene;5-[2-(2-ethylhex-5-enoxy)ethoxymethyl]hept-1-ene (PubChem CID 91296796) has the molecular formula C42H72O5 and a molecular weight of 657.03 g/mol. Its IUPAC name is 4-[2,3-bis(2-ethylpenta-3,4-dienoxy)propoxymethyl]hexa-1,2-diene;5-[2-(2-ethylhex-5-enoxy)ethoxymethyl]hept-1-ene.
| Compound Name | 4-[2,3-bis(2-ethylpenta-3,4-dienoxy)propoxymethyl]hexa-1,2-diene;5-[2-(2-ethylhex-5-enoxy)ethoxymethyl]hept-1-ene |
|---|---|
| PubChem CID | 91296796 |
| Molecular Formula | C42H72O5 |
| Molecular Weight | 657.03 g/mol |
| Exact Mass | 656.54 |
| IUPAC Name | 4-[2,3-bis(2-ethylpenta-3,4-dienoxy)propoxymethyl]hexa-1,2-diene;5-[2-(2-ethylhex-5-enoxy)ethoxymethyl]hept-1-ene |
| SMILES | C=C=CC(CC)COCC(COCC(C=C=C)CC)OCC(C=C=C)CC.C=CCCC(CC)COCCOCC(CC)CCC=C |
| InChI | InChI=1S/C24H38O3.C18H34O2/c1-7-13-21(10-4)16-25-19-24(27-18-23(12-6)15-9-3)20-26-17-22(11-5)14-8-2;1-5-9-11-17(7-3)15-19-13-14-20-16-18(8-4)12-10-6-2/h13-15,21-24H,1-3,10-12,16-20H2,4-6H3;5-6,17-18H,1-2,7-16H2,3-4H3 |
| InChIKey | XWZZCKBQCUYSEE-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.03 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|