About 5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine
5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine (PubChem CID 91297553) has the molecular formula C10H9ClN2S
and a molecular weight of 224.72 g/mol. Its IUPAC name is 5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine.
Molecular Properties
| Compound Name | 5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine |
| PubChem CID | 91297553 |
| Molecular Formula | C10H9ClN2S |
| Molecular Weight | 224.72 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine |
| SMILES | Clc1cccc2c1N(C1CC1)C=NS2 |
| InChI | InChI=1S/C10H9ClN2S/c11-8-2-1-3-9-10(8)13(6-12-14-9)7-4-5-7/h1-3,6-7H,4-5H2 |
| InChIKey | PYUJYBPSSVDXPI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.72 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine?
The IUPAC name of 5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine (CID 91297553) is 5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine.
What is the SMILES notation for 5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine?
The canonical SMILES for 5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine is Clc1cccc2c1N(C1CC1)C=NS2.
What is the InChIKey of 5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine?
The InChIKey is PYUJYBPSSVDXPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2S/c11-8-2-1-3-9-10(8)13(6-12-14-9)7-4-5-7/h1-3,6-7H,4-5H2.
What are the key properties of 5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine?
5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine has a molecular weight of 224.72 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-cyclopropyl-1,2,4-benzothiadiazine is sourced from PubChem (CID 91297553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).