C24H29NO12 — CID 91297686
2-[(1-benzyl-2,2,3,3,4,5,5,6,6-nonahydroxypiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one (PubChem CID 91297686) has the molecular formula C24H29NO12 and a molecular weight of 523.49 g/mol. Its IUPAC name is 2-[(1-benzyl-2,2,3,3,4,5,5,6,6-nonahydroxypiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one.
| Compound Name | 2-[(1-benzyl-2,2,3,3,4,5,5,6,6-nonahydroxypiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 91297686 |
| Molecular Formula | C24H29NO12 |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 2-[(1-benzyl-2,2,3,3,4,5,5,6,6-nonahydroxypiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CC1(O)C(O)(O)C(O)(O)N(Cc3ccccc3)C(O)(O)C1(O)O)C2 |
| InChI | InChI=1S/C24H29NO12/c1-36-17-9-14-8-15(19(26)16(14)10-18(17)37-2)11-20(27)21(28,29)23(32,33)25(24(34,35)22(20,30)31)12-13-6-4-3-5-7-13/h3-7,9-10,15,27-35H,8,11-12H2,1-2H3 |
| InChIKey | KAIBYUDTBQLQHT-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 220.84 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|