C26H41N3 — CID 91298077
N-cyclohexa-1,5-dien-1-yl-N-[4-(4-piperidin-1-ylpiperidin-1-yl)butyl]cyclohexa-1,5-dien-1-amine (PubChem CID 91298077) has the molecular formula C26H41N3 and a molecular weight of 395.64 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-N-[4-(4-piperidin-1-ylpiperidin-1-yl)butyl]cyclohexa-1,5-dien-1-amine.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-N-[4-(4-piperidin-1-ylpiperidin-1-yl)butyl]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 91298077 |
| Molecular Formula | C26H41N3 |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 395.33 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-N-[4-(4-piperidin-1-ylpiperidin-1-yl)butyl]cyclohexa-1,5-dien-1-amine |
| SMILES | C1=CC(N(CCCCN2CCC(N3CCCCC3)CC2)C2=CCCC=C2)=CCC1 |
| InChI | InChI=1S/C26H41N3/c1-4-12-25(13-5-1)29(26-14-6-2-7-15-26)21-11-10-18-27-22-16-24(17-23-27)28-19-8-3-9-20-28/h4,6,12-15,24H,1-3,5,7-11,16-23H2 |
| InChIKey | BRXXAVGISRWVKR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|