C13H26 — CID 91298161
1,6-dimethylcycloundecane (PubChem CID 91298161) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is 1,6-dimethylcycloundecane.
| Compound Name | 1,6-dimethylcycloundecane |
|---|---|
| PubChem CID | 91298161 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 1,6-dimethylcycloundecane |
| SMILES | CC1CCCCCC(C)CCCC1 |
| InChI | InChI=1S/C13H26/c1-12-8-4-3-5-9-13(2)11-7-6-10-12/h12-13H,3-11H2,1-2H3 |
| InChIKey | TXYQOIHZSYUWMT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |