C28H35Cl3N4O5S — CID 91298291
tert-butyl 2-[4-[[methyl-[5-[methyl-(2,3,4-trichlorophenyl)sulfonylamino]pentanoyl]amino]methyl]phenyl]-4,5-dihydroimidazole-1-carboxylate (PubChem CID 91298291) has the molecular formula C28H35Cl3N4O5S and a molecular weight of 646.04 g/mol. Its IUPAC name is tert-butyl 2-[4-[[methyl-[5-[methyl-(2,3,4-trichlorophenyl)sulfonylamino]pentanoyl]amino]methyl]phenyl]-4,5-dihydroimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-[4-[[methyl-[5-[methyl-(2,3,4-trichlorophenyl)sulfonylamino]pentanoyl]amino]methyl]phenyl]-4,5-dihydroimidazole-1-carboxylate |
|---|---|
| PubChem CID | 91298291 |
| Molecular Formula | C28H35Cl3N4O5S |
| Molecular Weight | 646.04 g/mol |
| Exact Mass | 644.14 |
| IUPAC Name | tert-butyl 2-[4-[[methyl-[5-[methyl-(2,3,4-trichlorophenyl)sulfonylamino]pentanoyl]amino]methyl]phenyl]-4,5-dihydroimidazole-1-carboxylate |
| SMILES | CN(Cc1ccc(C2=NCCN2C(=O)OC(C)(C)C)cc1)C(=O)CCCCN(C)S(=O)(=O)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C28H35Cl3N4O5S/c1-28(2,3)40-27(37)35-17-15-32-26(35)20-11-9-19(10-12-20)18-33(4)23(36)8-6-7-16-34(5)41(38,39)22-14-13-21(29)24(30)25(22)31/h9-14H,6-8,15-18H2,1-5H3 |
| InChIKey | NGCAMMICXIXOLJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 99.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.04 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|