About 1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione
1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione (PubChem CID 91298642) has the molecular formula C12H12N4O2
and a molecular weight of 244.25 g/mol. Its IUPAC name is 1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione.
Molecular Properties
| Compound Name | 1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione |
| PubChem CID | 91298642 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione |
| SMILES | [H]/N=C/CC(=O)/C(=N\[H])C(=O)C/C=N/c1ccncc1 |
| InChI | InChI=1S/C12H12N4O2/c13-5-1-10(17)12(14)11(18)4-8-16-9-2-6-15-7-3-9/h2-3,5-8,13-14H,1,4H2/b13-5+,14-12+,16-8+ |
| InChIKey | JWEOJJPNMKNCTG-YOEMTRCXSA-N |
| XLogP | 1.37 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione?
The IUPAC name of 1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione (CID 91298642) is 1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione.
What is the SMILES notation for 1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione?
The canonical SMILES for 1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione is [H]/N=C/CC(=O)/C(=N\[H])C(=O)C/C=N/c1ccncc1.
What is the InChIKey of 1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione?
The InChIKey is JWEOJJPNMKNCTG-YOEMTRCXSA-N. The full InChI is InChI=1S/C12H12N4O2/c13-5-1-10(17)12(14)11(18)4-8-16-9-2-6-15-7-3-9/h2-3,5-8,13-14H,1,4H2/b13-5+,14-12+,16-8+.
What are the key properties of 1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione?
1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione has a molecular weight of 244.25 g/mol, XLogP of 1.37, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diimino-7-pyridin-4-yliminoheptane-3,5-dione is sourced from PubChem (CID 91298642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).