About [[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate
[[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate (PubChem CID 91298674) has the molecular formula C17H23NO6
and a molecular weight of 337.37 g/mol. Its IUPAC name is [[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate.
Molecular Properties
| Compound Name | [[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate |
| PubChem CID | 91298674 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate |
| SMILES | CCCC(=O)ONC(=O)OC1CCC(c2ccc(O)cc2O)CC1 |
| InChI | InChI=1S/C17H23NO6/c1-2-3-16(21)24-18-17(22)23-13-7-4-11(5-8-13)14-9-6-12(19)10-15(14)20/h6,9-11,13,19-20H,2-5,7-8H2,1H3,(H,18,22) |
| InChIKey | PRLHKPTUCAMTJN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate?
The IUPAC name of [[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate (CID 91298674) is [[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate.
What is the SMILES notation for [[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate?
The canonical SMILES for [[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate is CCCC(=O)ONC(=O)OC1CCC(c2ccc(O)cc2O)CC1.
What is the InChIKey of [[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate?
The InChIKey is PRLHKPTUCAMTJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO6/c1-2-3-16(21)24-18-17(22)23-13-7-4-11(5-8-13)14-9-6-12(19)10-15(14)20/h6,9-11,13,19-20H,2-5,7-8H2,1H3,(H,18,22).
What are the key properties of [[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate?
[[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate has a molecular weight of 337.37 g/mol, XLogP of 3.11, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[4-(2,4-dihydroxyphenyl)cyclohexyl]oxycarbonylamino] butanoate is sourced from PubChem (CID 91298674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).