C6H11NO — CID 91298691
1,1,2,2,3,3-hexadeuterio-5-nitrosocyclohexane (PubChem CID 91298691) has the molecular formula C6H11NO and a molecular weight of 119.20 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexadeuterio-5-nitrosocyclohexane.
| Compound Name | 1,1,2,2,3,3-hexadeuterio-5-nitrosocyclohexane |
|---|---|
| PubChem CID | 91298691 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 119.20 g/mol |
| Exact Mass | 119.12 |
| IUPAC Name | 1,1,2,2,3,3-hexadeuterio-5-nitrosocyclohexane |
| SMILES | [2H]C1([2H])CC(N=O)CC([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C6H11NO/c8-7-6-4-2-1-3-5-6/h6H,1-5H2/i1D2,2D2,3D2 |
| InChIKey | AFLQDEOAJRGCOW-NMFSSPJFSA-N |
| XLogP | 2.09 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |