C8H14F6 — CID 91298869
1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;propane (PubChem CID 91298869) has the molecular formula C8H14F6 and a molecular weight of 224.19 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;propane.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;propane |
|---|---|
| PubChem CID | 91298869 |
| Molecular Formula | C8H14F6 |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane;propane |
| SMILES | CC(C)(C(F)(F)F)C(F)(F)F.CCC |
| InChI | InChI=1S/C5H6F6.C3H8/c1-3(2,4(6,7)8)5(9,10)11;1-3-2/h1-2H3;3H2,1-2H3 |
| InChIKey | XKSXKBVXLCMXJP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |