C23H44 — CID 91299152
6-ethyl-2,6,9,13-tetramethyl-4,11-dimethylidenepentadecane (PubChem CID 91299152) has the molecular formula C23H44 and a molecular weight of 320.61 g/mol. Its IUPAC name is 6-ethyl-2,6,9,13-tetramethyl-4,11-dimethylidenepentadecane.
| Compound Name | 6-ethyl-2,6,9,13-tetramethyl-4,11-dimethylidenepentadecane |
|---|---|
| PubChem CID | 91299152 |
| Molecular Formula | C23H44 |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 320.34 |
| IUPAC Name | 6-ethyl-2,6,9,13-tetramethyl-4,11-dimethylidenepentadecane |
| SMILES | C=C(CC(C)CC)CC(C)CCC(C)(CC)CC(=C)CC(C)C |
| InChI | InChI=1S/C23H44/c1-10-19(5)15-21(7)16-20(6)12-13-23(9,11-2)17-22(8)14-18(3)4/h18-20H,7-8,10-17H2,1-6,9H3 |
| InChIKey | VLLBZSMHWQRDOO-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|