C8H9N3 — CID 91299495
2,3,5-triazatricyclo[5.2.2.02,6]undeca-3,5,8-triene (PubChem CID 91299495) has the molecular formula C8H9N3 and a molecular weight of 147.18 g/mol. Its IUPAC name is 2,3,5-triazatricyclo[5.2.2.02,6]undeca-3,5,8-triene.
| Compound Name | 2,3,5-triazatricyclo[5.2.2.02,6]undeca-3,5,8-triene |
|---|---|
| PubChem CID | 91299495 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 2,3,5-triazatricyclo[5.2.2.02,6]undeca-3,5,8-triene |
| SMILES | C1=CC2CCC1c1ncnn12 |
| InChI | InChI=1S/C8H9N3/c1-3-7-4-2-6(1)8-9-5-10-11(7)8/h1,3,5-7H,2,4H2 |
| InChIKey | HLUVELYWODGWHV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|