C24H36 — CID 91299568
ethane;1,2,3,4,5-pentamethyl-6-[(2,3,5,6-tetramethylphenyl)methyl]benzene (PubChem CID 91299568) has the molecular formula C24H36 and a molecular weight of 324.55 g/mol. Its IUPAC name is ethane;1,2,3,4,5-pentamethyl-6-[(2,3,5,6-tetramethylphenyl)methyl]benzene.
| Compound Name | ethane;1,2,3,4,5-pentamethyl-6-[(2,3,5,6-tetramethylphenyl)methyl]benzene |
|---|---|
| PubChem CID | 91299568 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | ethane;1,2,3,4,5-pentamethyl-6-[(2,3,5,6-tetramethylphenyl)methyl]benzene |
| SMILES | CC.Cc1cc(C)c(C)c(Cc2c(C)c(C)c(C)c(C)c2C)c1C |
| InChI | InChI=1S/C22H30.C2H6/c1-12-10-13(2)15(4)21(14(12)3)11-22-19(8)17(6)16(5)18(7)20(22)9;1-2/h10H,11H2,1-9H3;1-2H3 |
| InChIKey | HVEXZODDNQLVMQ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |