C29H33N5O3S — CID 91299767
4-[5-[4-[5-ethyl-2-(pyridin-3-ylmethylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 91299767) has the molecular formula C29H33N5O3S and a molecular weight of 531.68 g/mol. Its IUPAC name is 4-[5-[4-[5-ethyl-2-(pyridin-3-ylmethylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[5-[4-[5-ethyl-2-(pyridin-3-ylmethylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 91299767 |
| Molecular Formula | C29H33N5O3S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 4-[5-[4-[5-ethyl-2-(pyridin-3-ylmethylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | CCc1sc(NCc2cccnc2)nc1-c1ccc(OCCCCCOc2ccc(C(N)=NO)cc2)cc1 |
| InChI | InChI=1S/C29H33N5O3S/c1-2-26-27(33-29(38-26)32-20-21-7-6-16-31-19-21)22-8-12-24(13-9-22)36-17-4-3-5-18-37-25-14-10-23(11-15-25)28(30)34-35/h6-16,19,35H,2-5,17-18,20H2,1H3,(H2,30,34)(H,32,33) |
| InChIKey | JYOAABQNOIKTDS-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 114.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|