C20H17F6N3O4S — CID 91299913
[2-[1-amino-3-phenyl-3-(trifluoromethyl)-4H-isoquinolin-6-yl]ethylsulfonylamino] 2,2,2-trifluoroacetate (PubChem CID 91299913) has the molecular formula C20H17F6N3O4S and a molecular weight of 509.43 g/mol. Its IUPAC name is [2-[1-amino-3-phenyl-3-(trifluoromethyl)-4H-isoquinolin-6-yl]ethylsulfonylamino] 2,2,2-trifluoroacetate.
| Compound Name | [2-[1-amino-3-phenyl-3-(trifluoromethyl)-4H-isoquinolin-6-yl]ethylsulfonylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91299913 |
| Molecular Formula | C20H17F6N3O4S |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | [2-[1-amino-3-phenyl-3-(trifluoromethyl)-4H-isoquinolin-6-yl]ethylsulfonylamino] 2,2,2-trifluoroacetate |
| SMILES | NC1=NC(c2ccccc2)(C(F)(F)F)Cc2cc(CCS(=O)(=O)NOC(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H17F6N3O4S/c21-19(22,23)17(30)33-29-34(31,32)9-8-12-6-7-15-13(10-12)11-18(20(24,25)26,28-16(15)27)14-4-2-1-3-5-14/h1-7,10,29H,8-9,11H2,(H2,27,28) |
| InChIKey | BLXDRJOKKULJFX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|