C13H21NS — CID 91300174
N-pentyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine (PubChem CID 91300174) has the molecular formula C13H21NS and a molecular weight of 223.38 g/mol. Its IUPAC name is N-pentyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine.
| Compound Name | N-pentyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine |
|---|---|
| PubChem CID | 91300174 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-pentyl-2,3,3a,7a-tetrahydro-1-benzothiophen-2-amine |
| SMILES | CCCCCNC1CC2C=CC=CC2S1 |
| InChI | InChI=1S/C13H21NS/c1-2-3-6-9-14-13-10-11-7-4-5-8-12(11)15-13/h4-5,7-8,11-14H,2-3,6,9-10H2,1H3 |
| InChIKey | BUXWKBIJMIDGGY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|