C24H33N3O2 — CID 9130047
N-[2-[(2S)-butan-2-yl]phenyl]-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 9130047) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[2-[(2S)-butan-2-yl]phenyl]-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[2-[(2S)-butan-2-yl]phenyl]-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9130047 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-[2-[(2S)-butan-2-yl]phenyl]-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)CN1CCN(Cc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C24H33N3O2/c1-4-19(2)22-7-5-6-8-23(22)25-24(28)18-27-15-13-26(14-16-27)17-20-9-11-21(29-3)12-10-20/h5-12,19H,4,13-18H2,1-3H3,(H,25,28)/t19-/m0/s1 |
| InChIKey | KDZUADZJTWMSPX-IBGZPJMESA-N |
| XLogP | 3.96 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |