About 3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol
3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol (PubChem CID 91300632) has the molecular formula C23H21N3O3S
and a molecular weight of 419.51 g/mol. Its IUPAC name is 3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol.
Molecular Properties
| Compound Name | 3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol |
| PubChem CID | 91300632 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol |
| SMILES | C=S(=O)(Nc1ccc2nccc(Nc3cc(O)cc(OC)c3)c2c1)c1ccccc1 |
| InChI | InChI=1S/C23H21N3O3S/c1-29-19-13-17(12-18(27)15-19)25-23-10-11-24-22-9-8-16(14-21(22)23)26-30(2,28)20-6-4-3-5-7-20/h3-15,27H,2H2,1H3,(H,24,25)(H,26,28) |
| InChIKey | KHGNCANPTLBLKX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol?
The IUPAC name of 3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol (CID 91300632) is 3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol.
What is the SMILES notation for 3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol?
The canonical SMILES for 3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol is C=S(=O)(Nc1ccc2nccc(Nc3cc(O)cc(OC)c3)c2c1)c1ccccc1.
What is the InChIKey of 3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol?
The InChIKey is KHGNCANPTLBLKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O3S/c1-29-19-13-17(12-18(27)15-19)25-23-10-11-24-22-9-8-16(14-21(22)23)26-30(2,28)20-6-4-3-5-7-20/h3-15,27H,2H2,1H3,(H,24,25)(H,26,28).
What are the key properties of 3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol?
3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol has a molecular weight of 419.51 g/mol, XLogP of 4.80, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5-[[6-[(methylidene-oxo-phenyl-λ6-sulfanyl)amino]quinolin-4-yl]amino]phenol is sourced from PubChem (CID 91300632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).