C24H38O5 — CID 91301150
trans-(2R,3R)-2-(11-hydroxy-3,7,11-trimethyldodeca-2,6,9-trienyl)-5,6-dimethoxy-3-methylcyclohexane-1,4-dione (PubChem CID 91301150) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is trans-(2R,3R)-2-(11-hydroxy-3,7,11-trimethyldodeca-2,6,9-trienyl)-5,6-dimethoxy-3-methylcyclohexane-1,4-dione.
| Compound Name | trans-(2R,3R)-2-(11-hydroxy-3,7,11-trimethyldodeca-2,6,9-trienyl)-5,6-dimethoxy-3-methylcyclohexane-1,4-dione |
|---|---|
| PubChem CID | 91301150 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | trans-(2R,3R)-2-(11-hydroxy-3,7,11-trimethyldodeca-2,6,9-trienyl)-5,6-dimethoxy-3-methylcyclohexane-1,4-dione |
| SMILES | COC1C(=O)[C@H](C)[C@@H](CC=C(C)CCC=C(C)CC=CC(C)(C)O)C(=O)C1OC |
| InChI | InChI=1S/C24H38O5/c1-16(12-9-15-24(4,5)27)10-8-11-17(2)13-14-19-18(3)20(25)22(28-6)23(29-7)21(19)26/h9-10,13,15,18-19,22-23,27H,8,11-12,14H2,1-7H3/t18-,19-,22?,23?/m1/s1 |
| InChIKey | RSNAOXPBXUWDQG-WSUXWNOTSA-N |
| XLogP | 4.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|