C26H45N7O3 — CID 91301592
N-(3-cyano-1-cyclohexylpyrrolidin-3-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4,4-dimethylpentanamide (PubChem CID 91301592) has the molecular formula C26H45N7O3 and a molecular weight of 503.69 g/mol. Its IUPAC name is N-(3-cyano-1-cyclohexylpyrrolidin-3-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4,4-dimethylpentanamide.
| Compound Name | N-(3-cyano-1-cyclohexylpyrrolidin-3-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 91301592 |
| Molecular Formula | C26H45N7O3 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.36 |
| IUPAC Name | N-(3-cyano-1-cyclohexylpyrrolidin-3-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4,4-dimethylpentanamide |
| SMILES | CCNC(=O)N/C(=N\C(CC(C)(C)C)C(=O)NC1(C#N)CCN(C2CCCCC2)C1)N1CCOCC1 |
| InChI | InChI=1S/C26H45N7O3/c1-5-28-24(35)30-23(32-13-15-36-16-14-32)29-21(17-25(2,3)4)22(34)31-26(18-27)11-12-33(19-26)20-9-7-6-8-10-20/h20-21H,5-17,19H2,1-4H3,(H,31,34)(H2,28,29,30,35) |
| InChIKey | GWRXPRGEGAOFCQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|