C27H38F2N4O2 — CID 91301678
3-(3,4-difluorophenyl)-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-5,8,9-trimethyl-5,6,7,8,10,10a-hexahydro-4aH-pyrido[3,4-c]azocine-1-carboxamide (PubChem CID 91301678) has the molecular formula C27H38F2N4O2 and a molecular weight of 488.62 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-5,8,9-trimethyl-5,6,7,8,10,10a-hexahydro-4aH-pyrido[3,4-c]azocine-1-carboxamide.
| Compound Name | 3-(3,4-difluorophenyl)-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-5,8,9-trimethyl-5,6,7,8,10,10a-hexahydro-4aH-pyrido[3,4-c]azocine-1-carboxamide |
|---|---|
| PubChem CID | 91301678 |
| Molecular Formula | C27H38F2N4O2 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-5,8,9-trimethyl-5,6,7,8,10,10a-hexahydro-4aH-pyrido[3,4-c]azocine-1-carboxamide |
| SMILES | CNC(=O)C(NC(=O)C1=NC(c2ccc(F)c(F)c2)=CC2C(C)CCC(C)N(C)CC12)C(C)(C)C |
| InChI | InChI=1S/C27H38F2N4O2/c1-15-8-9-16(2)33(7)14-19-18(15)13-22(17-10-11-20(28)21(29)12-17)31-23(19)25(34)32-24(26(35)30-6)27(3,4)5/h10-13,15-16,18-19,24H,8-9,14H2,1-7H3,(H,30,35)(H,32,34) |
| InChIKey | LLPFJEHZYZIGEI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |