C34H50FNO5Si — CID 91301700
methyl 2-[(4R,6S)-2,2-ditert-butyl-6-[2-[4-(4-fluorophenyl)-5-(hydroxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]ethenyl]-1,3,2-dioxasilinan-4-yl]acetate (PubChem CID 91301700) has the molecular formula C34H50FNO5Si and a molecular weight of 599.86 g/mol. Its IUPAC name is methyl 2-[(4R,6S)-2,2-ditert-butyl-6-[2-[4-(4-fluorophenyl)-5-(hydroxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]ethenyl]-1,3,2-dioxasilinan-4-yl]acetate.
| Compound Name | methyl 2-[(4R,6S)-2,2-ditert-butyl-6-[2-[4-(4-fluorophenyl)-5-(hydroxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]ethenyl]-1,3,2-dioxasilinan-4-yl]acetate |
|---|---|
| PubChem CID | 91301700 |
| Molecular Formula | C34H50FNO5Si |
| Molecular Weight | 599.86 g/mol |
| Exact Mass | 599.34 |
| IUPAC Name | methyl 2-[(4R,6S)-2,2-ditert-butyl-6-[2-[4-(4-fluorophenyl)-5-(hydroxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]ethenyl]-1,3,2-dioxasilinan-4-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@@H](C=Cc2c(C(C)C)nc(C(C)C)c(CO)c2-c2ccc(F)cc2)O[Si](C(C)(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C34H50FNO5Si/c1-21(2)31-27(30(23-12-14-24(35)15-13-23)28(20-37)32(36-31)22(3)4)17-16-25-18-26(19-29(38)39-11)41-42(40-25,33(5,6)7)34(8,9)10/h12-17,21-22,25-26,37H,18-20H2,1-11H3/t25-,26-/m1/s1 |
| InChIKey | UPIXYHPBMSMKKC-CLJLJLNGSA-N |
| XLogP | 8.42 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.86 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|