C24H29NO8S — CID 91301900
N-[4-[(4S,5R)-18-hydroxy-4,5-dimethyl-2,8,9,10-tetraoxo-3-oxabicyclo[12.4.0]octadeca-1(18),14,16-trien-15-yl]but-3-ynyl]methanesulfonamide (PubChem CID 91301900) has the molecular formula C24H29NO8S and a molecular weight of 491.56 g/mol. Its IUPAC name is N-[4-[(4S,5R)-18-hydroxy-4,5-dimethyl-2,8,9,10-tetraoxo-3-oxabicyclo[12.4.0]octadeca-1(18),14,16-trien-15-yl]but-3-ynyl]methanesulfonamide.
| Compound Name | N-[4-[(4S,5R)-18-hydroxy-4,5-dimethyl-2,8,9,10-tetraoxo-3-oxabicyclo[12.4.0]octadeca-1(18),14,16-trien-15-yl]but-3-ynyl]methanesulfonamide |
|---|---|
| PubChem CID | 91301900 |
| Molecular Formula | C24H29NO8S |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N-[4-[(4S,5R)-18-hydroxy-4,5-dimethyl-2,8,9,10-tetraoxo-3-oxabicyclo[12.4.0]octadeca-1(18),14,16-trien-15-yl]but-3-ynyl]methanesulfonamide |
| SMILES | C[C@@H]1CCC(=O)C(=O)C(=O)CCCc2c(C#CCCNS(C)(=O)=O)ccc(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C24H29NO8S/c1-15-10-12-21(28)23(29)20(27)9-6-8-18-17(7-4-5-14-25-34(3,31)32)11-13-19(26)22(18)24(30)33-16(15)2/h11,13,15-16,25-26H,5-6,8-10,12,14H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | RACFJGCWFSWTGK-CVEARBPZSA-N |
| XLogP | 1.69 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|