About 5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole
5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole (PubChem CID 91302221) has the molecular formula C9H9N3OS
and a molecular weight of 207.26 g/mol. Its IUPAC name is 5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole |
| PubChem CID | 91302221 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole |
| SMILES | c1nc(-c2cc(C3CCN3)on2)cs1 |
| InChI | InChI=1S/C9H9N3OS/c1-2-10-6(1)9-3-7(12-13-9)8-4-14-5-11-8/h3-6,10H,1-2H2 |
| InChIKey | DHWMNPROMPNETN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole?
The IUPAC name of 5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole (CID 91302221) is 5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole.
What is the SMILES notation for 5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole?
The canonical SMILES for 5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole is c1nc(-c2cc(C3CCN3)on2)cs1.
What is the InChIKey of 5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole?
The InChIKey is DHWMNPROMPNETN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3OS/c1-2-10-6(1)9-3-7(12-13-9)8-4-14-5-11-8/h3-6,10H,1-2H2.
What are the key properties of 5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole?
5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole has a molecular weight of 207.26 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(azetidin-2-yl)-3-(1,3-thiazol-4-yl)-1,2-oxazole is sourced from PubChem (CID 91302221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).