About 6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol
6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol (PubChem CID 91302285) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol |
| PubChem CID | 91302285 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol |
| SMILES | CC(O)CNC=C1CC=CC=C1O |
| InChI | InChI=1S/C10H15NO2/c1-8(12)6-11-7-9-4-2-3-5-10(9)13/h2-3,5,7-8,11-13H,4,6H2,1H3 |
| InChIKey | QNBBBQHKNUNTQK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol?
The IUPAC name of 6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol (CID 91302285) is 6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol?
The canonical SMILES for 6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol is CC(O)CNC=C1CC=CC=C1O.
What is the InChIKey of 6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol?
The InChIKey is QNBBBQHKNUNTQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-8(12)6-11-7-9-4-2-3-5-10(9)13/h2-3,5,7-8,11-13H,4,6H2,1H3.
What are the key properties of 6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol?
6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol has a molecular weight of 181.23 g/mol, XLogP of 1.24, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-hydroxypropylamino)methylidene]cyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 91302285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).