About 1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one
1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one (PubChem CID 91303297) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one.
Molecular Properties
| Compound Name | 1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one |
| PubChem CID | 91303297 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one |
| SMILES | C=C=C=C1C(C)CC(=O)N1C |
| InChI | InChI=1S/C9H11NO/c1-4-5-8-7(2)6-9(11)10(8)3/h7H,1,6H2,2-3H3 |
| InChIKey | KCPBMYYJHABFNL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one?
The IUPAC name of 1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one (CID 91303297) is 1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one.
What is the SMILES notation for 1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one?
The canonical SMILES for 1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one is C=C=C=C1C(C)CC(=O)N1C.
What is the InChIKey of 1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one?
The InChIKey is KCPBMYYJHABFNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-4-5-8-7(2)6-9(11)10(8)3/h7H,1,6H2,2-3H3.
What are the key properties of 1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one?
1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one has a molecular weight of 149.19 g/mol, XLogP of 1.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-5-propa-1,2-dienylidenepyrrolidin-2-one is sourced from PubChem (CID 91303297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).