C17H19N5OS — CID 913034
4-benzyl-5-hydrazinyl-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 913034) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is 4-benzyl-5-hydrazinyl-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-benzyl-5-hydrazinyl-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 913034 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-benzyl-5-hydrazinyl-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | CN1CCc2c(sc3nc(NN)n(Cc4ccccc4)c(=O)c23)C1 |
| InChI | InChI=1S/C17H19N5OS/c1-21-8-7-12-13(10-21)24-15-14(12)16(23)22(17(19-15)20-18)9-11-5-3-2-4-6-11/h2-6H,7-10,18H2,1H3,(H,19,20) |
| InChIKey | VISBLMRPAHCVKF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|