About fluoromethane;1-methyl-4-phenylmethoxybenzene
fluoromethane;1-methyl-4-phenylmethoxybenzene (PubChem CID 91304163) has the molecular formula C15H17FO
and a molecular weight of 232.30 g/mol. Its IUPAC name is fluoromethane;1-methyl-4-phenylmethoxybenzene.
Molecular Properties
| Compound Name | fluoromethane;1-methyl-4-phenylmethoxybenzene |
| PubChem CID | 91304163 |
| Molecular Formula | C15H17FO |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | fluoromethane;1-methyl-4-phenylmethoxybenzene |
| SMILES | CF.Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O.CH3F/c1-12-7-9-14(10-8-12)15-11-13-5-3-2-4-6-13;1-2/h2-10H,11H2,1H3;1H3 |
| InChIKey | FXVBMOYOAGKVFM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze fluoromethane;1-methyl-4-phenylmethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;1-methyl-4-phenylmethoxybenzene?
The IUPAC name of fluoromethane;1-methyl-4-phenylmethoxybenzene (CID 91304163) is fluoromethane;1-methyl-4-phenylmethoxybenzene.
What is the SMILES notation for fluoromethane;1-methyl-4-phenylmethoxybenzene?
The canonical SMILES for fluoromethane;1-methyl-4-phenylmethoxybenzene is CF.Cc1ccc(OCc2ccccc2)cc1.
What is the InChIKey of fluoromethane;1-methyl-4-phenylmethoxybenzene?
The InChIKey is FXVBMOYOAGKVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.CH3F/c1-12-7-9-14(10-8-12)15-11-13-5-3-2-4-6-13;1-2/h2-10H,11H2,1H3;1H3.
What are the key properties of fluoromethane;1-methyl-4-phenylmethoxybenzene?
fluoromethane;1-methyl-4-phenylmethoxybenzene has a molecular weight of 232.30 g/mol, XLogP of 4.16, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;1-methyl-4-phenylmethoxybenzene is sourced from PubChem (CID 91304163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).