C12H18N2O6 — CID 91304172
(2,5-dihydroxypyrrol-1-yl) 3-(tert-butylcarbamoyloxy)propanoate (PubChem CID 91304172) has the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-(tert-butylcarbamoyloxy)propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-(tert-butylcarbamoyloxy)propanoate |
|---|---|
| PubChem CID | 91304172 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-(tert-butylcarbamoyloxy)propanoate |
| SMILES | CC(C)(C)NC(=O)OCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C12H18N2O6/c1-12(2,3)13-11(18)19-7-6-10(17)20-14-8(15)4-5-9(14)16/h4-5,15-16H,6-7H2,1-3H3,(H,13,18) |
| InChIKey | NPJJUQHSJPNYTF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |