C16H14N2O — CID 91304275
7,8,12,12a-tetrahydronaphtho[2,1-c]cinnolin-8-ol (PubChem CID 91304275) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 7,8,12,12a-tetrahydronaphtho[2,1-c]cinnolin-8-ol.
| Compound Name | 7,8,12,12a-tetrahydronaphtho[2,1-c]cinnolin-8-ol |
|---|---|
| PubChem CID | 91304275 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 7,8,12,12a-tetrahydronaphtho[2,1-c]cinnolin-8-ol |
| SMILES | OC1Cc2nnc3ccccc3c2C2CC=CC=C12 |
| InChI | InChI=1S/C16H14N2O/c19-15-9-14-16(11-6-2-1-5-10(11)15)12-7-3-4-8-13(12)17-18-14/h1-5,7-8,11,15,19H,6,9H2 |
| InChIKey | GIAQPJSGOLFLDR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |