About 1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone
1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone (PubChem CID 91304403) has the molecular formula C22H32N2O
and a molecular weight of 340.51 g/mol. Its IUPAC name is 1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone |
| PubChem CID | 91304403 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone |
| SMILES | CNc1cc2c(cc1C)CC(C)(C)N=C2CC(=O)C1CCCCCC1 |
| InChI | InChI=1S/C22H32N2O/c1-15-11-17-14-22(2,3)24-20(18(17)12-19(15)23-4)13-21(25)16-9-7-5-6-8-10-16/h11-12,16,23H,5-10,13-14H2,1-4H3 |
| InChIKey | FHIRQUMSVGYBOM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone?
The IUPAC name of 1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone (CID 91304403) is 1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone.
What is the SMILES notation for 1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone?
The canonical SMILES for 1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone is CNc1cc2c(cc1C)CC(C)(C)N=C2CC(=O)C1CCCCCC1.
What is the InChIKey of 1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone?
The InChIKey is FHIRQUMSVGYBOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32N2O/c1-15-11-17-14-22(2,3)24-20(18(17)12-19(15)23-4)13-21(25)16-9-7-5-6-8-10-16/h11-12,16,23H,5-10,13-14H2,1-4H3.
What are the key properties of 1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone?
1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone has a molecular weight of 340.51 g/mol, XLogP of 5.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloheptyl-2-[3,3,6-trimethyl-7-(methylamino)-4H-isoquinolin-1-yl]ethanone is sourced from PubChem (CID 91304403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).