C15H16N2O2 — CID 91304934
2-hexa-2,4-dien-3-yl-6-methyl-1H-benzimidazole-4-carboxylic acid (PubChem CID 91304934) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-hexa-2,4-dien-3-yl-6-methyl-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 2-hexa-2,4-dien-3-yl-6-methyl-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 91304934 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-hexa-2,4-dien-3-yl-6-methyl-1H-benzimidazole-4-carboxylic acid |
| SMILES | CC=CC(=CC)c1nc2c(C(=O)O)cc(C)cc2[nH]1 |
| InChI | InChI=1S/C15H16N2O2/c1-4-6-10(5-2)14-16-12-8-9(3)7-11(15(18)19)13(12)17-14/h4-8H,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | KNFJLDBHHPSUDS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|