C17H20N6O15S2 — CID 91305502
5-[(3-azido-1-carboxypropyl)amino]-2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)-5-oxopentanoic acid (PubChem CID 91305502) has the molecular formula C17H20N6O15S2 and a molecular weight of 612.51 g/mol. Its IUPAC name is 5-[(3-azido-1-carboxypropyl)amino]-2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)-5-oxopentanoic acid.
| Compound Name | 5-[(3-azido-1-carboxypropyl)amino]-2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 91305502 |
| Molecular Formula | C17H20N6O15S2 |
| Molecular Weight | 612.51 g/mol |
| Exact Mass | 612.04 |
| IUPAC Name | 5-[(3-azido-1-carboxypropyl)amino]-2,2-bis(2,5-dihydroxy-3-sulfopyrrol-1-yl)-5-oxopentanoic acid |
| SMILES | [N-]=[N+]=NCCC(NC(=O)CCC(C(=O)O)(n1c(O)cc(S(=O)(=O)O)c1O)n1c(O)cc(S(=O)(=O)O)c1O)C(=O)O |
| InChI | InChI=1S/C17H20N6O15S2/c18-21-19-4-2-7(15(29)30)20-10(24)1-3-17(16(31)32,22-11(25)5-8(13(22)27)39(33,34)35)23-12(26)6-9(14(23)28)40(36,37)38/h5-7,25-28H,1-4H2,(H,20,24)(H,29,30)(H,31,32)(H,33,34,35)(H,36,37,38) |
| InChIKey | YUYDOROVLBFCON-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 351.98 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.51 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|