About 2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene
2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene (PubChem CID 91305725) has the molecular formula C20H34
and a molecular weight of 274.49 g/mol. Its IUPAC name is 2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene.
Molecular Properties
| Compound Name | 2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene |
| PubChem CID | 91305725 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene |
| SMILES | CCC(CC(C)CC(C)CC(C)C1CC1C)C1=C2CC21 |
| InChI | InChI=1S/C20H34/c1-6-16(20-18-11-19(18)20)9-13(3)7-12(2)8-14(4)17-10-15(17)5/h12-18H,6-11H2,1-5H3 |
| InChIKey | KIZOSYWZHAIBLF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene?
The IUPAC name of 2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene (CID 91305725) is 2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene.
What is the SMILES notation for 2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene?
The canonical SMILES for 2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene is CCC(CC(C)CC(C)CC(C)C1CC1C)C1=C2CC21.
What is the InChIKey of 2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene?
The InChIKey is KIZOSYWZHAIBLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34/c1-6-16(20-18-11-19(18)20)9-13(3)7-12(2)8-14(4)17-10-15(17)5/h12-18H,6-11H2,1-5H3.
What are the key properties of 2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene?
2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene has a molecular weight of 274.49 g/mol, XLogP of 6.08, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,7-dimethyl-9-(2-methylcyclopropyl)decan-3-yl]bicyclo[1.1.0]but-1-ene is sourced from PubChem (CID 91305725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).