About 3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane
3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane (PubChem CID 91306230) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is 3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane.
Molecular Properties
| Compound Name | 3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane |
| PubChem CID | 91306230 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane |
| SMILES | CC.CC.CC1=C(C)C2(CCNCC2)OC1 |
| InChI | InChI=1S/C10H17NO.2C2H6/c1-8-7-12-10(9(8)2)3-5-11-6-4-10;2*1-2/h11H,3-7H2,1-2H3;2*1-2H3 |
| InChIKey | OMNQOGAZIPARAD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane?
The IUPAC name of 3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane (CID 91306230) is 3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane.
What is the SMILES notation for 3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane?
The canonical SMILES for 3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane is CC.CC.CC1=C(C)C2(CCNCC2)OC1.
What is the InChIKey of 3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane?
The InChIKey is OMNQOGAZIPARAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO.2C2H6/c1-8-7-12-10(9(8)2)3-5-11-6-4-10;2*1-2/h11H,3-7H2,1-2H3;2*1-2H3.
What are the key properties of 3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane?
3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane has a molecular weight of 227.39 g/mol, XLogP of 3.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene;ethane is sourced from PubChem (CID 91306230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).