About (2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid
(2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid (PubChem CID 91306676) has the molecular formula C10H17NO5
and a molecular weight of 231.25 g/mol. Its IUPAC name is (2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | (2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid |
| PubChem CID | 91306676 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid |
| SMILES | CCO[C@H]1CN(C(=O)O)[C@@](CC)(C(=O)O)C1 |
| InChI | InChI=1S/C10H17NO5/c1-3-10(8(12)13)5-7(16-4-2)6-11(10)9(14)15/h7H,3-6H2,1-2H3,(H,12,13)(H,14,15)/t7-,10-/m1/s1 |
| InChIKey | OLQQENYSSXEVEC-GMSGAONNSA-N |
| XLogP | 1.01 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid?
The IUPAC name of (2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid (CID 91306676) is (2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid.
What is the SMILES notation for (2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid?
The canonical SMILES for (2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid is CCO[C@H]1CN(C(=O)O)[C@@](CC)(C(=O)O)C1.
What is the InChIKey of (2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid?
The InChIKey is OLQQENYSSXEVEC-GMSGAONNSA-N. The full InChI is InChI=1S/C10H17NO5/c1-3-10(8(12)13)5-7(16-4-2)6-11(10)9(14)15/h7H,3-6H2,1-2H3,(H,12,13)(H,14,15)/t7-,10-/m1/s1.
What are the key properties of (2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid?
(2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid has a molecular weight of 231.25 g/mol, XLogP of 1.01, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-4-ethoxy-2-ethylpyrrolidine-1,2-dicarboxylic acid is sourced from PubChem (CID 91306676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).