About ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide
ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide (PubChem CID 91307130) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide.
Molecular Properties
| Compound Name | ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide |
| PubChem CID | 91307130 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide |
| SMILES | CC.NC(=O)c1cccc2c1NCCC2=O |
| InChI | InChI=1S/C10H10N2O2.C2H6/c11-10(14)7-3-1-2-6-8(13)4-5-12-9(6)7;1-2/h1-3,12H,4-5H2,(H2,11,14);1-2H3 |
| InChIKey | ZNJAGANHYKWIRZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide?
The IUPAC name of ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide (CID 91307130) is ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide.
What is the SMILES notation for ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide?
The canonical SMILES for ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide is CC.NC(=O)c1cccc2c1NCCC2=O.
What is the InChIKey of ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide?
The InChIKey is ZNJAGANHYKWIRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2.C2H6/c11-10(14)7-3-1-2-6-8(13)4-5-12-9(6)7;1-2/h1-3,12H,4-5H2,(H2,11,14);1-2H3.
What are the key properties of ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide?
ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide has a molecular weight of 220.27 g/mol, XLogP of 1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-oxo-2,3-dihydro-1H-quinoline-8-carboxamide is sourced from PubChem (CID 91307130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).