About (1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate
(1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate (PubChem CID 91307148) has the molecular formula C23H20Cl2N2O3S
and a molecular weight of 475.40 g/mol. Its IUPAC name is (1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | (1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate |
| PubChem CID | 91307148 |
| Molecular Formula | C23H20Cl2N2O3S |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | (1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate |
| SMILES | NC(=O)C1(OC(=O)c2nc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)s2)CCCCC1 |
| InChI | InChI=1S/C23H20Cl2N2O3S/c24-16-8-4-14(5-9-16)18-19(15-6-10-17(25)11-7-15)31-20(27-18)21(28)30-23(22(26)29)12-2-1-3-13-23/h4-11H,1-3,12-13H2,(H2,26,29) |
| InChIKey | SUCLPFUFUSXTRN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate?
The IUPAC name of (1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate (CID 91307148) is (1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate.
What is the SMILES notation for (1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate?
The canonical SMILES for (1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate is NC(=O)C1(OC(=O)c2nc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)s2)CCCCC1.
What is the InChIKey of (1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate?
The InChIKey is SUCLPFUFUSXTRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20Cl2N2O3S/c24-16-8-4-14(5-9-16)18-19(15-6-10-17(25)11-7-15)31-20(27-18)21(28)30-23(22(26)29)12-2-1-3-13-23/h4-11H,1-3,12-13H2,(H2,26,29).
What are the key properties of (1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate?
(1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate has a molecular weight of 475.40 g/mol, XLogP of 6.13, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carbamoylcyclohexyl) 4,5-bis(4-chlorophenyl)-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 91307148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).