C16H19BNP — CID 91307247
1-pentyl-3-(4H-1,3-phosphaborol-2-yl)-2H-isoindole (PubChem CID 91307247) has the molecular formula C16H19BNP and a molecular weight of 267.12 g/mol. Its IUPAC name is 1-pentyl-3-(4H-1,3-phosphaborol-2-yl)-2H-isoindole.
| Compound Name | 1-pentyl-3-(4H-1,3-phosphaborol-2-yl)-2H-isoindole |
|---|---|
| PubChem CID | 91307247 |
| Molecular Formula | C16H19BNP |
| Molecular Weight | 267.12 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 1-pentyl-3-(4H-1,3-phosphaborol-2-yl)-2H-isoindole |
| SMILES | CCCCCc1[nH]c(C2=BCC=P2)c2ccccc12 |
| InChI | InChI=1S/C16H19BNP/c1-2-3-4-9-14-12-7-5-6-8-13(12)15(18-14)16-17-10-11-19-16/h5-8,11,18H,2-4,9-10H2,1H3 |
| InChIKey | GAPQAXOMMBBKND-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.12 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|