C29H41N5O2SSi — CID 91307674
1-[3-[[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(dimethylamino)but-2-en-1-one (PubChem CID 91307674) has the molecular formula C29H41N5O2SSi and a molecular weight of 551.83 g/mol. Its IUPAC name is 1-[3-[[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(dimethylamino)but-2-en-1-one.
| Compound Name | 1-[3-[[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(dimethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 91307674 |
| Molecular Formula | C29H41N5O2SSi |
| Molecular Weight | 551.83 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | 1-[3-[[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(dimethylamino)but-2-en-1-one |
| SMILES | CN(C)CC=CC(=O)N1CCc2c(sc3ncnc(N[C@H](CO[Si](C)(C)C(C)(C)C)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C29H41N5O2SSi/c1-29(2,3)38(6,7)36-19-23(21-12-9-8-10-13-21)32-27-26-22-15-17-34(25(35)14-11-16-33(4)5)18-24(22)37-28(26)31-20-30-27/h8-14,20,23H,15-19H2,1-7H3,(H,30,31,32)/t23-/m1/s1 |
| InChIKey | NNFVKNXCRYDQQQ-HSZRJFAPSA-N |
| XLogP | 5.87 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.83 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|