C28H38N4O2 — CID 91307707
3-[1-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-2-oxo-3,4-dihydroquinolin-3-yl]-N'-hydroxybenzenecarboximidamide (PubChem CID 91307707) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 3-[1-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-2-oxo-3,4-dihydroquinolin-3-yl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[1-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-2-oxo-3,4-dihydroquinolin-3-yl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 91307707 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 3-[1-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-2-oxo-3,4-dihydroquinolin-3-yl]-N'-hydroxybenzenecarboximidamide |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCCCN1C(=O)C(c2cccc(C(N)=NO)c2)Cc2ccccc21 |
| InChI | InChI=1S/C28H38N4O2/c1-20-10-8-11-21(2)31(20)16-6-3-7-17-32-26-15-5-4-12-23(26)19-25(28(32)33)22-13-9-14-24(18-22)27(29)30-34/h4-5,9,12-15,18,20-21,25,34H,3,6-8,10-11,16-17,19H2,1-2H3,(H2,29,30)/t20-,21+,25? |
| InChIKey | XAPBHIHAAAQTRS-KEVCNVLYSA-N |
| XLogP | 4.89 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|