C20H18N2O2 — CID 91307978
(1S,7R,8R,10S)-4-quinolin-6-yl-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol (PubChem CID 91307978) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (1S,7R,8R,10S)-4-quinolin-6-yl-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol.
| Compound Name | (1S,7R,8R,10S)-4-quinolin-6-yl-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 91307978 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (1S,7R,8R,10S)-4-quinolin-6-yl-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1-c1ccc3ncccc3c1)[C@@H]1CC[C@H]2[C@H]2C[C@H]21 |
| InChI | InChI=1S/C20H18N2O2/c23-19-17-12-4-5-13(15-9-14(12)15)18(17)20(24)22(19)11-3-6-16-10(8-11)2-1-7-21-16/h1-3,6-8,12-15,23-24H,4-5,9H2/t12-,13+,14+,15- |
| InChIKey | NWIMQXUCKSAQIP-PYHGIMPFSA-N |
| XLogP | 4.05 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |