C11H16ClN3OS2 — CID 91308335
6-chloro-N-ethyl-4-propan-2-yl-3H-thieno[3,2-e][1,2,4]thiadiazine-2-carboxamide (PubChem CID 91308335) has the molecular formula C11H16ClN3OS2 and a molecular weight of 305.86 g/mol. Its IUPAC name is 6-chloro-N-ethyl-4-propan-2-yl-3H-thieno[3,2-e][1,2,4]thiadiazine-2-carboxamide.
| Compound Name | 6-chloro-N-ethyl-4-propan-2-yl-3H-thieno[3,2-e][1,2,4]thiadiazine-2-carboxamide |
|---|---|
| PubChem CID | 91308335 |
| Molecular Formula | C11H16ClN3OS2 |
| Molecular Weight | 305.86 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 6-chloro-N-ethyl-4-propan-2-yl-3H-thieno[3,2-e][1,2,4]thiadiazine-2-carboxamide |
| SMILES | CCNC(=O)N1CN(C(C)C)c2cc(Cl)sc2S1 |
| InChI | InChI=1S/C11H16ClN3OS2/c1-4-13-11(16)15-6-14(7(2)3)8-5-9(12)17-10(8)18-15/h5,7H,4,6H2,1-3H3,(H,13,16) |
| InChIKey | ILMAMGWJBYIRAN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.86 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|