About [4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate
[4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate (PubChem CID 91308685) has the molecular formula C18H27Cl2NO3S
and a molecular weight of 408.39 g/mol. Its IUPAC name is [4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate |
| PubChem CID | 91308685 |
| Molecular Formula | C18H27Cl2NO3S |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCC(CCc1cccc(Cl)c1Cl)SCCCO |
| InChI | InChI=1S/C18H27Cl2NO3S/c1-18(2,3)21-17(23)24-12-14(25-11-5-10-22)9-8-13-6-4-7-15(19)16(13)20/h4,6-7,14,22H,5,8-12H2,1-3H3,(H,21,23) |
| InChIKey | AJHQJQOQWUJNBF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate?
The IUPAC name of [4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate (CID 91308685) is [4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate.
What is the SMILES notation for [4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate?
The canonical SMILES for [4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate is CC(C)(C)NC(=O)OCC(CCc1cccc(Cl)c1Cl)SCCCO.
What is the InChIKey of [4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate?
The InChIKey is AJHQJQOQWUJNBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27Cl2NO3S/c1-18(2,3)21-17(23)24-12-14(25-11-5-10-22)9-8-13-6-4-7-15(19)16(13)20/h4,6-7,14,22H,5,8-12H2,1-3H3,(H,21,23).
What are the key properties of [4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate?
[4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate has a molecular weight of 408.39 g/mol, XLogP of 4.93, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,3-dichlorophenyl)-2-(3-hydroxypropylsulfanyl)butyl] N-tert-butylcarbamate is sourced from PubChem (CID 91308685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).