About 3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone
3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone (PubChem CID 91309527) has the molecular formula C22H45N5O
and a molecular weight of 395.64 g/mol. Its IUPAC name is 3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone.
Molecular Properties
| Compound Name | 3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone |
| PubChem CID | 91309527 |
| Molecular Formula | C22H45N5O |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 395.36 |
| IUPAC Name | 3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone |
| SMILES | C1CCC2(CC1)CCNCC2.CC(=O)N1CCNCC1.CCN1CCNCC1 |
| InChI | InChI=1S/C10H19N.C6H12N2O.C6H14N2/c1-2-4-10(5-3-1)6-8-11-9-7-10;1-6(9)8-4-2-7-3-5-8;1-2-8-5-3-7-4-6-8/h11H,1-9H2;7H,2-5H2,1H3;7H,2-6H2,1H3 |
| InChIKey | WLGUWOHVROUMOU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone?
The IUPAC name of 3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone (CID 91309527) is 3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone.
What is the SMILES notation for 3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone?
The canonical SMILES for 3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone is C1CCC2(CC1)CCNCC2.CC(=O)N1CCNCC1.CCN1CCNCC1.
What is the InChIKey of 3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone?
The InChIKey is WLGUWOHVROUMOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N.C6H12N2O.C6H14N2/c1-2-4-10(5-3-1)6-8-11-9-7-10;1-6(9)8-4-2-7-3-5-8;1-2-8-5-3-7-4-6-8/h11H,1-9H2;7H,2-5H2,1H3;7H,2-6H2,1H3.
What are the key properties of 3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone?
3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone has a molecular weight of 395.64 g/mol, XLogP of 1.67, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azaspiro[5.5]undecane;1-ethylpiperazine;1-piperazin-1-ylethanone is sourced from PubChem (CID 91309527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).